p-Chloro-m-cresol
-
CAS Number 59-50-7
-
Catalog Number io-1964
-
Classification Aryl Halides
-
Molecular Weight 142.5800
-
SMILES CC1=C(C=CC(=C1)O)Cl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
4-chloro-m-cresol is a hydroxytoluene that is 3-methylphenol which is substituted by a chlorine at position 4. A ryanodine receptor agonist. It has a role as a ryanodine receptor agonist, an antimicrobial agent and a disinfectant. It is a hydroxytoluene and a member of monochlorobenzenes.
| 1 | 4-Chloro-3-methylphenol |
| 2 | Chlorocresol |
| 3 | 4-Chloro-m-cresol |
| 4 | p-Chloro-m-cresol |
| 5 | Phenol, 4-chloro-3-methyl- |
| Molecular Formula | C7H7ClO |
|---|---|
| Canonical SMILES | CC1=C(C=CC(=C1)O)Cl |
| Isomeric SMILES | CC1=C(C=CC(=C1)O)Cl |
| Molecular Weight | 142.5800 |
| InChIKey | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| InChI | InChI=1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| XLogP | 3.1000 |
| ExactMass | 142.0185 |
| MonoisotopicMass | 142.0185 |
| TPSA | 20.2000 |
| Complexity | 94.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 44386 |
| PatentFamilyCount | 13040 |
| LiteratureCount | 1323 |
