Cycloate
-
CAS Number 1134-23-2
-
Catalog Number io-2063
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 215.3600
-
SMILES CCN(C1CCCCC1)C(=O)SCC
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Cycloate can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | CYCLOATE |
| 2 | Etsan |
| 3 | Ro-Neet |
| 4 | Eurex |
| 5 | Ronit |
| Molecular Formula | C11H21NOS |
|---|---|
| Canonical SMILES | CCN(C1CCCCC1)C(=O)SCC |
| Isomeric SMILES | CCN(C1CCCCC1)C(=O)SCC |
| Molecular Weight | 215.3600 |
| InChIKey | DFCAFRGABIXSDS-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H21NOS/c1-3-12(11(13)14-4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| XLogP | 4.1000 |
| ExactMass | 215.1344 |
| MonoisotopicMass | 215.1344 |
| TPSA | 45.6000 |
| Complexity | 178.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 21116 |
| PatentFamilyCount | 4758 |
| LiteratureCount | 271 |