Dichloran
-
CAS Number 99-30-9
-
Catalog Number io-2138
-
Classification Amines
-
Molecular Weight 207.0100
-
SMILES C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
2,6-dichloro-4-nitroaniline is a nitroaniline that is 4-nitroaniline in which the hydrogens at positions 2 and 6 are replaced by chlorines. An agricultural fungicide, it is not approved for use in the European Union. It has a role as an antifungal agrochemical. It is a dichlorobenzene, an aromatic fungicide and a nitroaniline.
| 1 | 2,6-DICHLORO-4-NITROANILINE |
| 2 | Dichloran |
| 3 | Dicloran |
| 4 | Allisan |
| 5 | Botran |
| Molecular Formula | C6H4Cl2N2O2 |
|---|---|
| Canonical SMILES | C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-] |
| Isomeric SMILES | C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-] |
| Molecular Weight | 207.0100 |
| InChIKey | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| XLogP | 2.9000 |
| ExactMass | 205.9650 |
| MonoisotopicMass | 205.9650 |
| TPSA | 71.8000 |
| Complexity | 173.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 21961 |
| PatentFamilyCount | 6224 |
| LiteratureCount | 988 |