N,N-Dimethylaniline
-
CAS Number 121-69-7
-
Catalog Number io-2240
-
Classification Amines
-
Molecular Weight 121.1800
-
SMILES CN(C)C1=CC=CC=C1
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
N,N-dimethylaniline is a tertiary amine that is aniline in which the amino hydrogens are replaced by two methyl groups. It is a tertiary amine and a dimethylaniline.
| 1 | N,N-dimethylaniline |
| 2 | Dimethylaniline |
| 3 | Dimethylphenylamine |
| 4 | N,N-Dimethylbenzenamine |
| 5 | Benzenamine, N,N-dimethyl- |
| Molecular Formula | C8H11N |
|---|---|
| Canonical SMILES | CN(C)C1=CC=CC=C1 |
| Isomeric SMILES | CN(C)C1=CC=CC=C1 |
| Molecular Weight | 121.1800 |
| InChIKey | JLTDJTHDQAWBAV-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| XLogP | 2.3000 |
| ExactMass | 121.0891 |
| MonoisotopicMass | 121.0891 |
| TPSA | 3.2000 |
| Complexity | 72.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 82485 |
| PatentFamilyCount | 32543 |
| LiteratureCount | 4393 |