3,4-Dinitrotoluene
-
CAS Number 610-39-9
-
Catalog Number io-2277
-
Classification Nitro
-
Molecular Weight 182.1300
-
SMILES CC1=CC(=C(C=C1)[N+](=O)[O-])[N+](=O)[O-]
Size | QTY | Notes | |
---|---|---|---|
|
|
Add |
3,4-dinitrotoluene is a dinitrotoluene in which the methyl group is meta to one of the nitro groups and para to the other. A uellow crystalline compound that is virtually insoluble in water but dissolves in most organic solvents. It has a role as an explosive.
1 | 3,4-DINITROTOLUENE |
2 | 4-Methyl-1,2-dinitrobenzene |
3 | 3,4-DNT |
4 | Benzene, 4-methyl-1,2-dinitro- |
5 | Toluene, 3,4-dinitro- |
Molecular Formula | C7H6N2O4 |
---|---|
Canonical SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Isomeric SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Molecular Weight | 182.1300 |
InChIKey | INYDMNPNDHRJQJ-UHFFFAOYSA-N |
InChI | InChI=1S/C7H6N2O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3 |
XLogP | 2.1000 |
ExactMass | 182.0328 |
MonoisotopicMass | 182.0328 |
TPSA | 91.6000 |
Complexity | 220.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 4 |
RotatableBondCount | 0 |
HeavyAtomCount | 13 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 457 |
PatentFamilyCount | 188 |
LiteratureCount | 149 |