S-Ethyl dipropylthiocarbamate
-
CAS Number 759-94-4
-
Catalog Number io-2359
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 189.3200
-
SMILES CCCN(CCC)C(=O)SCC
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Ethyl Dipropylthiocarbamate can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | EPTC |
| 2 | S-Ethyl dipropylthiocarbamate |
| 3 | Torbin |
| 4 | EPTAM |
| 5 | Alirox |
| Molecular Formula | C9H19NOS |
|---|---|
| Canonical SMILES | CCCN(CCC)C(=O)SCC |
| Isomeric SMILES | CCCN(CCC)C(=O)SCC |
| Molecular Weight | 189.3200 |
| InChIKey | GUVLYNGULCJVDO-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H19NOS/c1-4-7-10(8-5-2)9(11)12-6-3/h4-8H2,1-3H3 |
| XLogP | 3.2000 |
| ExactMass | 189.1187 |
| MonoisotopicMass | 189.1187 |
| TPSA | 45.6000 |
| Complexity | 122.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 25781 |
| PatentFamilyCount | 5996 |
| LiteratureCount | 708 |