Methionine
-
CAS Number 63-68-3
-
Catalog Number io-39977
-
Classification Salts
-
Molecular Weight 149.2100
-
SMILES CSCCC(C(=O)O)N
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
L-methionine is the L-enantiomer of methionine. It has a role as a nutraceutical, a micronutrient, an antidote to paracetamol poisoning, a human metabolite and a mouse metabolite. It is an aspartate family amino acid, a proteinogenic amino acid, a methionine and a L-alpha-amino acid. It is a conjugate base of a L-methioninium. It is a conjugate acid of a L-methioninate. It is an enantiomer of a D-methionine. It is a tautomer of a L-methionine zwitterion.
| 1 | L-methionine |
| 2 | methionine |
| 3 | h-Met-oh |
| 4 | (S)-2-Amino-4-(methylthio)butanoic acid |
| 5 | Cymethion |
| Molecular Formula | C5H11NO2S |
|---|---|
| Canonical SMILES | CSCCC(C(=O)O)N |
| Isomeric SMILES | CSCC[C@@H](C(=O)O)N |
| Molecular Weight | 149.2100 |
| InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-N |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| XLogP | -1.9000 |
| ExactMass | 149.0510 |
| MonoisotopicMass | 149.0510 |
| TPSA | 88.6000 |
| Complexity | 97.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 1 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 48869 |
| PatentFamilyCount | 20332 |
| LiteratureCount | 35407 |
