(L)-ethyl lactate
-
CAS Number 687-47-8
-
Catalog Number io-406955
-
Molecular Weight 118.1300
-
SMILES
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Ethyl (2S)-lactate is the (2S)-enantiomer of ethyl lactate. It has a role as a Saccharomyces cerevisiae metabolite. It is an enantiomer of an ethyl (2R)-lactate.
| 1 | Ethyl L-lactate |
| 2 | (-)-ETHYL L-LACTATE |
| 3 | (L)-ethyl lactate |
| 4 | (L)-(-)-ethyl lactate |
| 5 | Ethyl (S)-2-hydroxypropionate |
| Molecular Formula | C5H10O3 |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 118.1300 |
| InChIKey | LZCLXQDLBQLTDK-BYPYZUCNSA-N |
| InChI | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m0/s1 |
| XLogP | 0.2000 |
| ExactMass | 118.0630 |
| MonoisotopicMass | 118.0630 |
| TPSA | 46.5000 |
| Complexity | 79.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 1 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 2907 |
| PatentFamilyCount | 865 |
| LiteratureCount | 114 |