Ammonium Acetate
-
CAS Number 631-61-8
-
Catalog Number io-1704
-
Classification Salts
-
Molecular Weight 77.0800
-
SMILES CC(=O)[O-].[NH4+]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Ammonium acetate is an ammonium salt obtained by reaction of ammonia with acetic acid. A deliquescent white crystalline solid, it has a relatively low melting point (114###) for a salt. Used as a food acidity regulator, although no longer approved for this purpose in the EU. It has a role as a food acidity regulator and a buffer. It is an acetate salt and an ammonium salt.
| 1 | AMMONIUM ACETATE |
| 2 | Acetic acid, ammonium salt |
| 3 | Azanium Acetate |
| 4 | acetic acid ammonium salt |
| 5 | azanium;acetate |
| Molecular Formula | C2H7NO2 |
|---|---|
| Canonical SMILES | CC(=O)[O-].[NH4+] |
| Isomeric SMILES | CC(=O)[O-].[NH4+] |
| Molecular Weight | 77.0800 |
| InChIKey | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
| XLogP | 0.0000 |
| ExactMass | 77.0477 |
| MonoisotopicMass | 77.0477 |
| TPSA | 41.1000 |
| Complexity | 25.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 3968 |
| PatentFamilyCount | 1943 |
| LiteratureCount | 28941 |
