Anilazine
-
CAS Number 101-05-3
-
Catalog Number io-1734
-
Classification Amines
-
Molecular Weight 275.5000
-
SMILES C1=CC=C(C(=C1)NC2=NC(=NC(=N2)Cl)Cl)Cl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Anilazine is a member of the class of triazenes that is dichlorotriazene in which the hydrogen is replaced by an o-chloroanilino group. A fungicide formerly used to control leaf spots and downy mildew, it is no longer approved for use within the European Union. It has a role as an antifungal agrochemical. It is a member of triazines, an organochlorine pesticide, a secondary amino compound and a member of monochlorobenzenes.
| 1 | Anilazine |
| 2 | DYRENE |
| 3 | Anilazin |
| 4 | Zinochlor |
| 5 | Kemate |
| Molecular Formula | C9H5Cl3N4 |
|---|---|
| Canonical SMILES | C1=CC=C(C(=C1)NC2=NC(=NC(=N2)Cl)Cl)Cl |
| Isomeric SMILES | C1=CC=C(C(=C1)NC2=NC(=NC(=N2)Cl)Cl)Cl |
| Molecular Weight | 275.5000 |
| InChIKey | IMHBYKMAHXWHRP-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) |
| XLogP | 3.0000 |
| ExactMass | 273.9580 |
| MonoisotopicMass | 273.9580 |
| TPSA | 50.7000 |
| Complexity | 221.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 16 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 154942 |
| PatentFamilyCount | 60617 |
| LiteratureCount | 212 |
