Atrazine
-
CAS Number 1912-24-9
-
Catalog Number io-1767
-
Classification Amines
-
Molecular Weight 215.6800
-
SMILES CCNC1=NC(=NC(=N1)Cl)NC(C)C
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Atrazine can cause developmental toxicity and female reproductive toxicity according to The Environmental Protection Agency (EPA).
| 1 | atrazine |
| 2 | Gesaprim |
| 3 | Atranex |
| 4 | Oleogesaprim |
| 5 | Atazinax |
| Molecular Formula | C8H14ClN5 |
|---|---|
| Canonical SMILES | CCNC1=NC(=NC(=N1)Cl)NC(C)C |
| Isomeric SMILES | CCNC1=NC(=NC(=N1)Cl)NC(C)C |
| Molecular Weight | 215.6800 |
| InChIKey | MXWJVTOOROXGIU-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14) |
| XLogP | 2.6000 |
| ExactMass | 215.0938 |
| MonoisotopicMass | 215.0938 |
| TPSA | 62.7000 |
| Complexity | 166.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 51418 |
| PatentFamilyCount | 15128 |
| LiteratureCount | 11832 |
