Azaserine
-
CAS Number 115-02-6
-
Catalog Number io-1769
-
Classification Acids
-
Molecular Weight 173.1300
-
SMILES C(C(C(=O)O)N)OC(=O)C=[N+]=[N-]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Azaserine can cause cancer according to an independent committee of scientific and health experts.
| 1 | azaserine |
| 2 | Azaserin |
| 3 | O-Diazoacetyl-L-serine |
| 4 | L-azaserine |
| 5 | L-Serine, diazoacetate (ester) |
| Molecular Formula | C5H7N3O4 |
|---|---|
| Canonical SMILES | C(C(C(=O)O)N)OC(=O)C=[N+]=[N-] |
| Isomeric SMILES | C([C@@H](C(=O)O)N)OC(=O)C=[N+]=[N-] |
| Molecular Weight | 173.1300 |
| InChIKey | MZZGOOYMKKIOOX-VKHMYHEASA-N |
| InChI | InChI=1S/C5H7N3O4/c6-3(5(10)11)2-12-4(9)1-8-7/h1,3H,2,6H2,(H,10,11)/t3-/m0/s1 |
| XLogP | -3.2000 |
| ExactMass | 173.0437 |
| MonoisotopicMass | 173.0437 |
| TPSA | 91.6000 |
| Complexity | 233.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 6 |
| RotatableBondCount | 5 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 1 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 1 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 1 |
| CovalentUnitCount | 1 |
| PatentCount | 27327 |
| PatentFamilyCount | 5887 |
| LiteratureCount | 701 |