delta-BHC
-
CAS Number 319-86-8
-
Catalog Number io-1824
-
Classification Halogenated Organic Compounds
-
Molecular Weight 290.8000
-
SMILES C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Hexachlorocyclohexane (all isomers including lindane) can cause cancer according to an independent committee of scientific and health experts.
| 1 | lindane |
| 2 | beta-HCH |
| 3 | alpha-HCH |
| 4 | 1,2,3,4,5,6-Hexachlorocyclohexane |
| 5 | gamma-HCH |
| Molecular Formula | C6H6Cl6 |
|---|---|
| Canonical SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
| Isomeric SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
| Molecular Weight | 290.8000 |
| InChIKey | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
| XLogP | 3.8000 |
| ExactMass | 289.8571 |
| MonoisotopicMass | 287.8601 |
| TPSA | 0.0000 |
| Complexity | 104.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 104118 |
| PatentFamilyCount | 40780 |
| LiteratureCount | 10591 |