sec-Butylamine
-
CAS Number 13952-84-6
-
Catalog Number io-1885
-
Classification Amines
-
Molecular Weight 73.1400
-
SMILES CCC(C)N
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Sec-butylamine is a primary aliphatic amine that is butane in which one hydrogen at position 2 is replaced by an amino group. A fumigant fungicide with a high potential for bioaccumulation, it is not approved for fungicidal use in the European Union. It has a role as an antifungal agrochemical. It is a primary aliphatic amine and an aliphatic nitrogen antifungal agent.
| 1 | SEC-BUTYLAMINE |
| 2 | butan-2-amine |
| 3 | 2-Butanamine |
| 4 | 2-Aminobutane |
| 5 | 2-Butylamine |
| Molecular Formula | C4H11N |
|---|---|
| Canonical SMILES | CCC(C)N |
| Isomeric SMILES | CCC(C)N |
| Molecular Weight | 73.1400 |
| InChIKey | BHRZNVHARXXAHW-UHFFFAOYSA-N |
| InChI | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
| XLogP | 0.6000 |
| ExactMass | 73.0891 |
| MonoisotopicMass | 73.0891 |
| TPSA | 26.0000 |
| Complexity | 19.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 35755 |
| PatentFamilyCount | 13035 |
| LiteratureCount | 520 |