C.I. Basic Green 4
-
CAS Number 569-64-2
-
Catalog Number io-2011
-
Classification Amines
-
Molecular Weight 364.9000
-
SMILES CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Malachite green is an organic chloride salt that is the monochloride salt of malachite green cation. Used as a green-coloured dye, as a counter-stain in histology, and for its anti-fungal properties in aquaculture. It has a role as a fluorochrome, a histological dye, an antifungal drug, a carcinogenic agent, a teratogenic agent, an environmental contaminant and an antibacterial agent. It contains a malachite green cation.
| 1 | MALACHITE GREEN |
| 2 | Basic Green 4 |
| 3 | Malachite green chloride |
| 4 | China Green |
| 5 | Victoria Green B |
| Molecular Formula | C23H25ClN2 |
|---|---|
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |
| Isomeric SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |
| Molecular Weight | 364.9000 |
| InChIKey | FDZZZRQASAIRJF-UHFFFAOYSA-M |
| InChI | InChI=1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
| XLogP | 0.0000 |
| ExactMass | 364.1706 |
| MonoisotopicMass | 364.1706 |
| TPSA | 6.2000 |
| Complexity | 516.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 26 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 55332 |
| PatentFamilyCount | 24544 |
| LiteratureCount | 6536 |
