C.I. Solvent Yellow 34
-
CAS Number 492-80-8
-
Catalog Number io-2023
-
Classification Amines
-
Molecular Weight 267.3700
-
SMILES CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Auramine can cause cancer according to an independent committee of scientific and health experts.
| 1 | AURAMINE |
| 2 | Yellow pyoctanine |
| 3 | Glauramine |
| 4 | Auramine base |
| 5 | Auramine O base |
| Molecular Formula | C17H21N3 |
|---|---|
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C |
| Isomeric SMILES | CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C |
| Molecular Weight | 267.3700 |
| InChIKey | JPIYZTWMUGTEHX-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 |
| XLogP | 4.0000 |
| ExactMass | 267.1735 |
| MonoisotopicMass | 267.1735 |
| TPSA | 30.3000 |
| Complexity | 278.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 20 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 22133 |
| PatentFamilyCount | 11227 |
| LiteratureCount | 1596 |
