Fenpropathrin
-
CAS Number 39515-41-8
-
Catalog Number io-2384
-
Classification Esters
-
Molecular Weight 349.4000
-
SMILES CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Fenpropathrin is a cyclopropanecarboxylate ester obtained by formal condensation between 2,2,3,3-tetramethylcyclopropanecarboxylic acid and cyano(3-phenoxyphenyl)methanol. It has a role as a pyrethroid ester insecticide, a pyrethroid ester acaricide and an agrochemical. It is an aromatic ether and a cyclopropanecarboxylate ester. It is functionally related to a 2,2,3,3-tetramethylcyclopropanecarboxylic acid.
| 1 | Fenpropathrin |
| 2 | Meothrin |
| 3 | Danimen |
| 4 | Danitol |
| 5 | Rody |
| Molecular Formula | C22H23NO3 |
|---|---|
| Canonical SMILES | CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C |
| Isomeric SMILES | CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C |
| Molecular Weight | 349.4000 |
| InChIKey | XQUXKZZNEFRCAW-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H23NO3/c1-21(2)19(22(21,3)4)20(24)26-18(14-23)15-9-8-12-17(13-15)25-16-10-6-5-7-11-16/h5-13,18-19H,1-4H3 |
| XLogP | 5.7000 |
| ExactMass | 349.1678 |
| MonoisotopicMass | 349.1678 |
| TPSA | 59.3000 |
| Complexity | 553.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 26 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 32058 |
| PatentFamilyCount | 8348 |
| LiteratureCount | 761 |