Fenthion
-
CAS Number 55-38-9
-
Catalog Number io-2386
-
Classification Esters
-
Molecular Weight 278.3000
-
SMILES CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Fenthion is an organic thiophosphate that is O,O-dimethyl hydrogen phosphorothioate in which the hydrogen atom of the hydroxy group is replaced by a 3-methyl-4-(methylsulfanyl)phenyl group. It exhibits acaricidal and insecticidal activities. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an acaricide, an agrochemical, an avicide, an EC 3.1.1.8 (cholinesterase) inhibitor and an insecticide. It is functionally related to a 4-(methylsulfanyl)-m-cresol.
| 1 | fenthion |
| 2 | Mercaptophos |
| 3 | Baytex |
| 4 | Spotton |
| 5 | Fenthione |
| Molecular Formula | C10H15O3PS2 |
|---|---|
| Canonical SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC |
| Isomeric SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC |
| Molecular Weight | 278.3000 |
| InChIKey | PNVJTZOFSHSLTO-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H15O3PS2/c1-8-7-9(5-6-10(8)16-4)13-14(15,11-2)12-3/h5-7H,1-4H3 |
| XLogP | 4.1000 |
| ExactMass | 278.0200 |
| MonoisotopicMass | 278.0200 |
| TPSA | 85.1000 |
| Complexity | 254.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 5 |
| HeavyAtomCount | 16 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 34328 |
| PatentFamilyCount | 9053 |
| LiteratureCount | 1787 |
