Lead acetate
-
CAS Number 301-04-2
-
Catalog Number io-2554
-
Classification Salts
-
Molecular Weight 325.0000
-
SMILES CC(=O)[O-].CC(=O)[O-].[Pb+2]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Lead Acetate can cause cancer according to an independent committee of scientific and health experts.
| 1 | LEAD ACETATE |
| 2 | Lead(II) acetate |
| 3 | Lead diacetate |
| 4 | Plumbous acetate |
| 5 | Salt of saturn |
| Molecular Formula | C4H6O4Pb |
|---|---|
| Canonical SMILES | CC(=O)[O-].CC(=O)[O-].[Pb+2] |
| Isomeric SMILES | CC(=O)[O-].CC(=O)[O-].[Pb+2] |
| Molecular Weight | 325.0000 |
| InChIKey | GUWSLQUAAYEZAF-UHFFFAOYSA-L |
| InChI | InChI=1S/2C2H4O2.Pb/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| XLogP | 0.0000 |
| ExactMass | 326.0033 |
| MonoisotopicMass | 326.0033 |
| TPSA | 80.3000 |
| Complexity | 25.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 9 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 35 |
| PatentFamilyCount | 19 |
| LiteratureCount | 1466 |
