Manganese, bis(dimethylcarbamodithioato-S,S')-
-
CAS Number 15339-36-3
-
Catalog Number io-2586
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 295.4000
-
SMILES CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Mn+2]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
No description available for this item
| 1 | Manganese dimethyldithiocarbamate |
| 2 | Manam |
| 3 | Manganous dimethyldithiocarbamate |
| 4 | N,N-dimethylcarbamodithioate;manganese(2+) |
| 5 | Tennam |
| Molecular Formula | C6H12MnN2S4 |
|---|---|
| Canonical SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Mn+2] |
| Isomeric SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Mn+2] |
| Molecular Weight | 295.4000 |
| InChIKey | KQUQKVGNBPTEFO-UHFFFAOYSA-L |
| InChI | InChI=1S/2C3H7NS2.Mn/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| XLogP | 0.0000 |
| ExactMass | 294.9264 |
| MonoisotopicMass | 294.9264 |
| TPSA | 72.7000 |
| Complexity | 54.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 13 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 374 |
| PatentFamilyCount | 155 |
| LiteratureCount | 0 |
