Sodium dimethyldithiocarbamate
-
CAS Number 128-04-1
-
Catalog Number io-3000
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 143.2100
-
SMILES CN(C)C(=S)[S-].[Na+]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Sodium dimethyldithiocarbamate can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | Sodium dimethyldithiocarbamate |
| 2 | Sodium dimethylcarbamodithioate |
| 3 | Dimethyldithiocarbamic acid sodium salt |
| 4 | Sodium dimethyl dithiocarbamate |
| 5 | Sanceler S |
| Molecular Formula | C3H6NNaS2 |
|---|---|
| Canonical SMILES | CN(C)C(=S)[S-].[Na+] |
| Isomeric SMILES | CN(C)C(=S)[S-].[Na+] |
| Molecular Weight | 143.2100 |
| InChIKey | VMSRVIHUFHQIAL-UHFFFAOYSA-M |
| InChI | InChI=1S/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 |
| XLogP | 0.0000 |
| ExactMass | 142.9839 |
| MonoisotopicMass | 142.9839 |
| TPSA | 36.3000 |
| Complexity | 64.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 7 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 7958 |
| PatentFamilyCount | 3797 |
| LiteratureCount | 207 |