Sodium o-phenylphenoxide
-
CAS Number 132-27-4
-
Catalog Number io-3011
-
Classification Phenolic Salts
-
Molecular Weight 192.1900
-
SMILES C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
o-Phenylphenate, Sodium can cause cancer according to The World Health Organization's International Agency for Research on Cancer (IARC).
| 1 | Sodium [1,1'-biphenyl]-2-olate |
| 2 | Sodium 2-biphenylate |
| 3 | Sodium o-phenylphenate |
| 4 | 2-Phenylphenol sodium salt |
| 5 | Sodium ortho-phenylphenate |
| Molecular Formula | C12H9NaO |
|---|---|
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] |
| Molecular Weight | 192.1900 |
| InChIKey | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| InChI | InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1/p-1 |
| XLogP | 0.0000 |
| ExactMass | 192.0551 |
| MonoisotopicMass | 192.0551 |
| TPSA | 23.1000 |
| Complexity | 154.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 8929 |
| PatentFamilyCount | 2764 |
| LiteratureCount | 340 |
