2,3,4,6-Tetrachlorophenol
-
CAS Number 58-90-2
-
Catalog Number io-3069
-
Classification Acids
-
Molecular Weight 231.9000
-
SMILES C1=C(C(=C(C(=C1Cl)Cl)Cl)O)Cl
Size | QTY | Notes | |
---|---|---|---|
|
|
Add |
2,3,4,6-tetrachlorophenol is a tetrachlorophenol in which the chlorines are located at positions 2, 3, 4, and 6. It has a role as a xenobiotic metabolite.
1 | 2,3,4,6-TETRACHLOROPHENOL |
2 | Dowicide 6 |
3 | 2,4,5,6-Tetrachlorophenol |
4 | Phenol, 2,3,4,6-tetrachloro- |
5 | Chlorophenols |
Molecular Formula | C6H2Cl4O |
---|---|
Canonical SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)O)Cl |
Isomeric SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)O)Cl |
Molecular Weight | 231.9000 |
InChIKey | VGVRPFIJEJYOFN-UHFFFAOYSA-N |
InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H |
XLogP | 4.5000 |
ExactMass | 231.8830 |
MonoisotopicMass | 229.8860 |
TPSA | 20.2000 |
Complexity | 143.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 1 |
RotatableBondCount | 0 |
HeavyAtomCount | 11 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 3430 |
PatentFamilyCount | 1759 |
LiteratureCount | 1966 |