Thiosemicarbazide
-
CAS Number 79-19-6
-
Catalog Number io-3107
-
Classification Azo
-
Molecular Weight 91.1400
-
SMILES C(=S)(N)NN
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Hydrazinecarbothioamide is a member of the class of thioureas that is thiourea in which a hydrogen of one of the amino groups is replaced by an amino group. It is a member of hydrazines, a thiocarboxamide and a member of thioureas.
| 1 | Thiosemicarbazide |
| 2 | Hydrazinecarbothioamide |
| 3 | aminothiourea |
| 4 | N-Aminothiourea |
| 5 | 1-Aminothiourea |
| Molecular Formula | CH5N3S |
|---|---|
| Canonical SMILES | C(=S)(N)NN |
| Isomeric SMILES | C(=S)(N)NN |
| Molecular Weight | 91.1400 |
| InChIKey | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
| InChI | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
| XLogP | -1.2000 |
| ExactMass | 91.0204 |
| MonoisotopicMass | 91.0204 |
| TPSA | 96.2000 |
| Complexity | 42.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 3 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 19342 |
| PatentFamilyCount | 7844 |
| LiteratureCount | 5710 |
