Phenazopyridine hydrochloride
-
CAS Number 136-40-3
-
Catalog Number io-40327
-
Classification Azo
-
Molecular Weight 249.7000
-
SMILES C1=CC=C(C=C1)N=NC2=C(N=C(C=C2)N)N.Cl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Phenazopyridine hydrochloride is a hydrochloride obtained by combining phenazopyridine with one equivalent of hydrochloric acid. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. It has a role as a carcinogenic agent, a local anaesthetic and a non-narcotic analgesic. It contains a phenazopyridine(1+).
| 1 | Phenazopyridine hydrochloride |
| 2 | Phenazopyridine HCl |
| 3 | Pyridium |
| 4 | Urodine |
| 5 | Mallophene |
| Molecular Formula | C11H12ClN5 |
|---|---|
| Canonical SMILES | C1=CC=C(C=C1)N=NC2=C(N=C(C=C2)N)N.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)N=NC2=C(N=C(C=C2)N)N.Cl |
| Molecular Weight | 249.7000 |
| InChIKey | QQBPIHBUCMDKFG-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H11N5.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;/h1-7H,(H4,12,13,14);1H |
| XLogP | 0.0000 |
| ExactMass | 249.0781 |
| MonoisotopicMass | 249.0781 |
| TPSA | 89.6000 |
| Complexity | 237.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 3 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 17 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 7530 |
| PatentFamilyCount | 3235 |
| LiteratureCount | 765 |
