N-tetracosanoylsphingosine
-
CAS Number 102917-80-6
-
Catalog Number io-406847
-
Molecular Weight 650.1000
-
SMILES
Size | QTY | Notes | |
---|---|---|---|
|
|
Add |
N-tetracosanoylsphingosine is a N-acylsphingosine in which the ceramide N-acyl group is specified as tetracosanoyl. It has a role as a mouse metabolite. It is a N-acylsphingosine, a Cer(d42:1) and a N-(very-long-chain fatty acyl)-sphingoid base. It is functionally related to a tetracosanoic acid.
1 | C24 Ceramide |
2 | Lignoceric Ceramide |
3 | N-tetracosanoylsphingosine |
4 | Cer(d18:1/24:0) |
5 | C24-Ceramide |
Molecular Formula | C42H83NO3 |
---|---|
Canonical SMILES | |
Isomeric SMILES | |
Molecular Weight | 650.1000 |
InChIKey | ZJVVOYPTFQEGPH-AUTSUKAISA-N |
InChI | InChI=1S/C42H83NO3/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-26-28-30-32-34-36-38-42(46)43-40(39-44)41(45)37-35-33-31-29-27-25-16-14-12-10-8-6-4-2/h35,37,40-41,44-45H,3-34,36,38-39H2,1-2H3,(H,43,46)/b37-35+/t40-,41+/m0/s1 |
XLogP | 17.2000 |
ExactMass | 649.6373 |
MonoisotopicMass | 649.6373 |
TPSA | 69.6000 |
Complexity | 622.0000 |
Charge | 0.0000 |
HBondDonorCount | 3 |
HBondAcceptorCount | 3 |
RotatableBondCount | 38 |
HeavyAtomCount | 46 |
IsotopeAtomCount | 0 |
AtomStereoCount | 2 |
DefinedAtomStereoCount | 2 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 1 |
DefinedBondStereoCount | 1 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 396 |
PatentFamilyCount | 147 |
LiteratureCount | 76 |