Acetic Acid Mixture with Hydrobromic Acid
-
CAS Number 37348-16-6
-
Catalog Number io-406939
-
Molecular Weight 140.9600
-
SMILES -
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
No description available for this item
| 1 | acetic acid;hydrobromide |
| 2 | Acetic acid, mixt. with hydrobromic acid |
| 3 | Acetic Acid Mixture with Hydrobromic Acid |
| 4 | acetic acid HBr |
| 5 | HBr acetic acid |
| Molecular Formula | C2H5BrO2 |
|---|---|
| Canonical SMILES | - |
| Isomeric SMILES | - |
| Molecular Weight | 140.9600 |
| InChIKey | MNZMECMQTYGSOI-UHFFFAOYSA-N |
| InChI | InChI=1S/C2H4O2.BrH/c1-2(3)4;/h1H3,(H,3,4);1H |
| XLogP | 0.0000 |
| ExactMass | 139.9500 |
| MonoisotopicMass | 139.9500 |
| TPSA | 37.3000 |
| Complexity | 31.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 6707 |
| PatentFamilyCount | 3096 |
| LiteratureCount | 143 |