Azobenzene
-
CAS Number 103-33-3
-
Catalog Number io-43545
-
Classification Azo
-
Molecular Weight 182.2200
-
SMILES C1=CC=C(C=C1)N=NC2=CC=CC=C2
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Azobenzene is a molecule whose structure comprises two phenyl rings linked by a N=N double bond; the parent compound of the azobenzene class of compounds.
| 1 | azobenzene |
| 2 | Diphenyldiazene |
| 3 | 1,2-Diphenyldiazene |
| 4 | (E)-1,2-Diphenyldiazene |
| 5 | Diazene, diphenyl- |
| Molecular Formula | C12H10N2 |
|---|---|
| Canonical SMILES | C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
| Isomeric SMILES | C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
| Molecular Weight | 182.2200 |
| InChIKey | DMLAVOWQYNRWNQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
| XLogP | 3.8000 |
| ExactMass | 182.0844 |
| MonoisotopicMass | 182.0844 |
| TPSA | 24.7000 |
| Complexity | 157.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 37127 |
| PatentFamilyCount | 15632 |
| LiteratureCount | 6278 |